C7H3F13O — CID 550386
2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-ol (PubChem CID 550386) has the molecular formula C7H3F13O and a molecular weight of 350.07 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-ol.
| Compound Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-ol |
|---|---|
| PubChem CID | 550386 |
| Molecular Formula | C7H3F13O |
| Molecular Weight | 350.07 g/mol |
| Exact Mass | 350.00 |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,7-tridecafluoroheptan-1-ol |
| SMILES | OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H3F13O/c8-2(9,1-21)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)20/h21H,1H2 |
| InChIKey | STLNAVFVCIRZLL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.07 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|