About 4-[5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]thiophen-3-yl]but-3-yn-1-ol
4-[5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]thiophen-3-yl]but-3-yn-1-ol (PubChem CID 55038607) has the molecular formula C14H15ClN2OS
and a molecular weight of 294.81 g/mol. Its IUPAC name is 4-[5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]thiophen-3-yl]but-3-yn-1-ol.
Molecular Properties
| Compound Name | 4-[5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]thiophen-3-yl]but-3-yn-1-ol |
| PubChem CID | 55038607 |
| Molecular Formula | C14H15ClN2OS |
| Molecular Weight | 294.81 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 4-[5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]thiophen-3-yl]but-3-yn-1-ol |
| SMILES | Cc1nn(Cc2cc(C#CCCO)cs2)c(C)c1Cl |
| InChI | InChI=1S/C14H15ClN2OS/c1-10-14(15)11(2)17(16-10)8-13-7-12(9-19-13)5-3-4-6-18/h7,9,18H,4,6,8H2,1-2H3 |
| InChIKey | UWRXWSBQVVZNKJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.81 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]thiophen-3-yl]but-3-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]thiophen-3-yl]but-3-yn-1-ol?
The IUPAC name of 4-[5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]thiophen-3-yl]but-3-yn-1-ol (CID 55038607) is 4-[5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]thiophen-3-yl]but-3-yn-1-ol.
What is the SMILES notation for 4-[5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]thiophen-3-yl]but-3-yn-1-ol?
The canonical SMILES for 4-[5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]thiophen-3-yl]but-3-yn-1-ol is Cc1nn(Cc2cc(C#CCCO)cs2)c(C)c1Cl.
What is the InChIKey of 4-[5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]thiophen-3-yl]but-3-yn-1-ol?
The InChIKey is UWRXWSBQVVZNKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15ClN2OS/c1-10-14(15)11(2)17(16-10)8-13-7-12(9-19-13)5-3-4-6-18/h7,9,18H,4,6,8H2,1-2H3.
What are the key properties of 4-[5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]thiophen-3-yl]but-3-yn-1-ol?
4-[5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]thiophen-3-yl]but-3-yn-1-ol has a molecular weight of 294.81 g/mol, XLogP of 3.00, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-[(4-chloro-3,5-dimethylpyrazol-1-yl)methyl]thiophen-3-yl]but-3-yn-1-ol is sourced from PubChem (CID 55038607), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).