About 1-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]ethanol
1-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]ethanol (PubChem CID 55038793) has the molecular formula C13H14ClFN2O
and a molecular weight of 268.72 g/mol. Its IUPAC name is 1-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]ethanol.
Molecular Properties
| Compound Name | 1-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]ethanol |
| PubChem CID | 55038793 |
| Molecular Formula | C13H14ClFN2O |
| Molecular Weight | 268.72 g/mol |
| Exact Mass | 268.08 |
| IUPAC Name | 1-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]ethanol |
| SMILES | Cc1nn(-c2ccc(C(C)O)cc2F)c(C)c1Cl |
| InChI | InChI=1S/C13H14ClFN2O/c1-7-13(14)8(2)17(16-7)12-5-4-10(9(3)18)6-11(12)15/h4-6,9,18H,1-3H3 |
| InChIKey | SWKXPCZQRHOULK-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.72 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]ethanol?
The IUPAC name of 1-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]ethanol (CID 55038793) is 1-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]ethanol.
What is the SMILES notation for 1-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]ethanol?
The canonical SMILES for 1-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]ethanol is Cc1nn(-c2ccc(C(C)O)cc2F)c(C)c1Cl.
What is the InChIKey of 1-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]ethanol?
The InChIKey is SWKXPCZQRHOULK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClFN2O/c1-7-13(14)8(2)17(16-7)12-5-4-10(9(3)18)6-11(12)15/h4-6,9,18H,1-3H3.
What are the key properties of 1-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]ethanol?
1-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]ethanol has a molecular weight of 268.72 g/mol, XLogP of 3.33, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-chloro-3,5-dimethylpyrazol-1-yl)-3-fluorophenyl]ethanol is sourced from PubChem (CID 55038793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).