C15H23ClN2 — CID 55039069
1-[4-(chloromethyl)-3-methylphenyl]-N,N-dimethylpiperidin-4-amine (PubChem CID 55039069) has the molecular formula C15H23ClN2 and a molecular weight of 266.82 g/mol. Its IUPAC name is 1-[4-(chloromethyl)-3-methylphenyl]-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-[4-(chloromethyl)-3-methylphenyl]-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 55039069 |
| Molecular Formula | C15H23ClN2 |
| Molecular Weight | 266.82 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 1-[4-(chloromethyl)-3-methylphenyl]-N,N-dimethylpiperidin-4-amine |
| SMILES | Cc1cc(N2CCC(N(C)C)CC2)ccc1CCl |
| InChI | InChI=1S/C15H23ClN2/c1-12-10-15(5-4-13(12)11-16)18-8-6-14(7-9-18)17(2)3/h4-5,10,14H,6-9,11H2,1-3H3 |
| InChIKey | ROKDMIGCYMKFDF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.82 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|