C15H7F13N4O2 — CID 550402
N-(4-fluorophenyl)-4,6-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-amine (PubChem CID 550402) has the molecular formula C15H7F13N4O2 and a molecular weight of 522.22 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4,6-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-amine.
| Compound Name | N-(4-fluorophenyl)-4,6-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 550402 |
| Molecular Formula | C15H7F13N4O2 |
| Molecular Weight | 522.22 g/mol |
| Exact Mass | 522.04 |
| IUPAC Name | N-(4-fluorophenyl)-4,6-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-amine |
| SMILES | Fc1ccc(Nc2nc(OC(C(F)(F)F)C(F)(F)F)nc(OC(C(F)(F)F)C(F)(F)F)n2)cc1 |
| InChI | InChI=1S/C15H7F13N4O2/c16-5-1-3-6(4-2-5)29-9-30-10(33-7(12(17,18)19)13(20,21)22)32-11(31-9)34-8(14(23,24)25)15(26,27)28/h1-4,7-8H,(H,29,30,31,32) |
| InChIKey | QSSKGRXDAWNJSG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.22 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |