C13H18BrN3O — CID 55042048
2-amino-5-bromo-N-(1-methylcyclohexyl)pyridine-3-carboxamide (PubChem CID 55042048) has the molecular formula C13H18BrN3O and a molecular weight of 312.21 g/mol. Its IUPAC name is 2-amino-5-bromo-N-(1-methylcyclohexyl)pyridine-3-carboxamide.
| Compound Name | 2-amino-5-bromo-N-(1-methylcyclohexyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 55042048 |
| Molecular Formula | C13H18BrN3O |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-amino-5-bromo-N-(1-methylcyclohexyl)pyridine-3-carboxamide |
| SMILES | CC1(NC(=O)c2cc(Br)cnc2N)CCCCC1 |
| InChI | InChI=1S/C13H18BrN3O/c1-13(5-3-2-4-6-13)17-12(18)10-7-9(14)8-16-11(10)15/h7-8H,2-6H2,1H3,(H2,15,16)(H,17,18) |
| InChIKey | GCDUZJIJDJGOSJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |