C13H19N3O2 — CID 55042246
[4-(hydroxymethyl)piperidin-1-yl]-[4-(methylamino)-2-pyridinyl]methanone (PubChem CID 55042246) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is [4-(hydroxymethyl)piperidin-1-yl]-[4-(methylamino)-2-pyridinyl]methanone.
| Compound Name | [4-(hydroxymethyl)piperidin-1-yl]-[4-(methylamino)-2-pyridinyl]methanone |
|---|---|
| PubChem CID | 55042246 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | [4-(hydroxymethyl)piperidin-1-yl]-[4-(methylamino)-2-pyridinyl]methanone |
| SMILES | CNc1ccnc(C(=O)N2CCC(CO)CC2)c1 |
| InChI | InChI=1S/C13H19N3O2/c1-14-11-2-5-15-12(8-11)13(18)16-6-3-10(9-17)4-7-16/h2,5,8,10,17H,3-4,6-7,9H2,1H3,(H,14,15) |
| InChIKey | MUMQVCNYGRCRRB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |