About 4-[[5-(ethylamino)-1,3-dimethylpyrazol-4-yl]methylsulfanyl]phenol
4-[[5-(ethylamino)-1,3-dimethylpyrazol-4-yl]methylsulfanyl]phenol (PubChem CID 55044477) has the molecular formula C14H19N3OS
and a molecular weight of 277.39 g/mol. Its IUPAC name is 4-[[5-(ethylamino)-1,3-dimethylpyrazol-4-yl]methylsulfanyl]phenol.
Molecular Properties
| Compound Name | 4-[[5-(ethylamino)-1,3-dimethylpyrazol-4-yl]methylsulfanyl]phenol |
| PubChem CID | 55044477 |
| Molecular Formula | C14H19N3OS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 4-[[5-(ethylamino)-1,3-dimethylpyrazol-4-yl]methylsulfanyl]phenol |
| SMILES | CCNc1c(CSc2ccc(O)cc2)c(C)nn1C |
| InChI | InChI=1S/C14H19N3OS/c1-4-15-14-13(10(2)16-17(14)3)9-19-12-7-5-11(18)6-8-12/h5-8,15,18H,4,9H2,1-3H3 |
| InChIKey | VQZPSJSPNUOCHR-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[5-(ethylamino)-1,3-dimethylpyrazol-4-yl]methylsulfanyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[5-(ethylamino)-1,3-dimethylpyrazol-4-yl]methylsulfanyl]phenol?
The IUPAC name of 4-[[5-(ethylamino)-1,3-dimethylpyrazol-4-yl]methylsulfanyl]phenol (CID 55044477) is 4-[[5-(ethylamino)-1,3-dimethylpyrazol-4-yl]methylsulfanyl]phenol.
What is the SMILES notation for 4-[[5-(ethylamino)-1,3-dimethylpyrazol-4-yl]methylsulfanyl]phenol?
The canonical SMILES for 4-[[5-(ethylamino)-1,3-dimethylpyrazol-4-yl]methylsulfanyl]phenol is CCNc1c(CSc2ccc(O)cc2)c(C)nn1C.
What is the InChIKey of 4-[[5-(ethylamino)-1,3-dimethylpyrazol-4-yl]methylsulfanyl]phenol?
The InChIKey is VQZPSJSPNUOCHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3OS/c1-4-15-14-13(10(2)16-17(14)3)9-19-12-7-5-11(18)6-8-12/h5-8,15,18H,4,9H2,1-3H3.
What are the key properties of 4-[[5-(ethylamino)-1,3-dimethylpyrazol-4-yl]methylsulfanyl]phenol?
4-[[5-(ethylamino)-1,3-dimethylpyrazol-4-yl]methylsulfanyl]phenol has a molecular weight of 277.39 g/mol, XLogP of 3.16, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[5-(ethylamino)-1,3-dimethylpyrazol-4-yl]methylsulfanyl]phenol is sourced from PubChem (CID 55044477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).