About N-methyl-3-(2,2,2-trifluoroethoxymethyl)quinolin-2-amine
N-methyl-3-(2,2,2-trifluoroethoxymethyl)quinolin-2-amine (PubChem CID 55044919) has the molecular formula C13H13F3N2O
and a molecular weight of 270.25 g/mol. Its IUPAC name is N-methyl-3-(2,2,2-trifluoroethoxymethyl)quinolin-2-amine.
Molecular Properties
| Compound Name | N-methyl-3-(2,2,2-trifluoroethoxymethyl)quinolin-2-amine |
| PubChem CID | 55044919 |
| Molecular Formula | C13H13F3N2O |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | N-methyl-3-(2,2,2-trifluoroethoxymethyl)quinolin-2-amine |
| SMILES | CNc1nc2ccccc2cc1COCC(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O/c1-17-12-10(7-19-8-13(14,15)16)6-9-4-2-3-5-11(9)18-12/h2-6H,7-8H2,1H3,(H,17,18) |
| InChIKey | FGFMHXLKSQEQRI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-3-(2,2,2-trifluoroethoxymethyl)quinolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-(2,2,2-trifluoroethoxymethyl)quinolin-2-amine?
The IUPAC name of N-methyl-3-(2,2,2-trifluoroethoxymethyl)quinolin-2-amine (CID 55044919) is N-methyl-3-(2,2,2-trifluoroethoxymethyl)quinolin-2-amine.
What is the SMILES notation for N-methyl-3-(2,2,2-trifluoroethoxymethyl)quinolin-2-amine?
The canonical SMILES for N-methyl-3-(2,2,2-trifluoroethoxymethyl)quinolin-2-amine is CNc1nc2ccccc2cc1COCC(F)(F)F.
What is the InChIKey of N-methyl-3-(2,2,2-trifluoroethoxymethyl)quinolin-2-amine?
The InChIKey is FGFMHXLKSQEQRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13F3N2O/c1-17-12-10(7-19-8-13(14,15)16)6-9-4-2-3-5-11(9)18-12/h2-6H,7-8H2,1H3,(H,17,18).
What are the key properties of N-methyl-3-(2,2,2-trifluoroethoxymethyl)quinolin-2-amine?
N-methyl-3-(2,2,2-trifluoroethoxymethyl)quinolin-2-amine has a molecular weight of 270.25 g/mol, XLogP of 3.36, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-(2,2,2-trifluoroethoxymethyl)quinolin-2-amine is sourced from PubChem (CID 55044919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).