C16H20F6N2O4 — CID 550450
3,6-di(butan-2-yl)-1,4-bis(2,2,2-trifluoroacetyl)piperazine-2,5-dione (PubChem CID 550450) has the molecular formula C16H20F6N2O4 and a molecular weight of 418.33 g/mol. Its IUPAC name is 3,6-di(butan-2-yl)-1,4-bis(2,2,2-trifluoroacetyl)piperazine-2,5-dione.
| Compound Name | 3,6-di(butan-2-yl)-1,4-bis(2,2,2-trifluoroacetyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 550450 |
| Molecular Formula | C16H20F6N2O4 |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 3,6-di(butan-2-yl)-1,4-bis(2,2,2-trifluoroacetyl)piperazine-2,5-dione |
| SMILES | CCC(C)C1C(=O)N(C(=O)C(F)(F)F)C(C(C)CC)C(=O)N1C(=O)C(F)(F)F |
| InChI | InChI=1S/C16H20F6N2O4/c1-5-7(3)9-11(25)24(14(28)16(20,21)22)10(8(4)6-2)12(26)23(9)13(27)15(17,18)19/h7-10H,5-6H2,1-4H3 |
| InChIKey | QWMZTZRIQOEREC-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |