About 4-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-N-propylthiadiazol-5-amine
4-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-N-propylthiadiazol-5-amine (PubChem CID 55045006) has the molecular formula C9H16N4O2S2
and a molecular weight of 276.39 g/mol. Its IUPAC name is 4-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-N-propylthiadiazol-5-amine.
Molecular Properties
| Compound Name | 4-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-N-propylthiadiazol-5-amine |
| PubChem CID | 55045006 |
| Molecular Formula | C9H16N4O2S2 |
| Molecular Weight | 276.39 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 4-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-N-propylthiadiazol-5-amine |
| SMILES | CCCNc1snnc1CN1CCCS1(=O)=O |
| InChI | InChI=1S/C9H16N4O2S2/c1-2-4-10-9-8(11-12-16-9)7-13-5-3-6-17(13,14)15/h10H,2-7H2,1H3 |
| InChIKey | ULEDKWXINJSCFS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.39 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-N-propylthiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-N-propylthiadiazol-5-amine?
The IUPAC name of 4-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-N-propylthiadiazol-5-amine (CID 55045006) is 4-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-N-propylthiadiazol-5-amine.
What is the SMILES notation for 4-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-N-propylthiadiazol-5-amine?
The canonical SMILES for 4-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-N-propylthiadiazol-5-amine is CCCNc1snnc1CN1CCCS1(=O)=O.
What is the InChIKey of 4-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-N-propylthiadiazol-5-amine?
The InChIKey is ULEDKWXINJSCFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N4O2S2/c1-2-4-10-9-8(11-12-16-9)7-13-5-3-6-17(13,14)15/h10H,2-7H2,1H3.
What are the key properties of 4-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-N-propylthiadiazol-5-amine?
4-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-N-propylthiadiazol-5-amine has a molecular weight of 276.39 g/mol, XLogP of 0.90, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1,1-dioxo-1,2-thiazolidin-2-yl)methyl]-N-propylthiadiazol-5-amine is sourced from PubChem (CID 55045006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).