About 2-(3-chlorophenyl)-N,5,6-trimethylpyrimidin-4-amine
2-(3-chlorophenyl)-N,5,6-trimethylpyrimidin-4-amine (PubChem CID 55045730) has the molecular formula C13H14ClN3
and a molecular weight of 247.73 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-N,5,6-trimethylpyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)-N,5,6-trimethylpyrimidin-4-amine |
| PubChem CID | 55045730 |
| Molecular Formula | C13H14ClN3 |
| Molecular Weight | 247.73 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 2-(3-chlorophenyl)-N,5,6-trimethylpyrimidin-4-amine |
| SMILES | CNc1nc(-c2cccc(Cl)c2)nc(C)c1C |
| InChI | InChI=1S/C13H14ClN3/c1-8-9(2)16-13(17-12(8)15-3)10-5-4-6-11(14)7-10/h4-7H,1-3H3,(H,15,16,17) |
| InChIKey | RALMONBTPCWLMK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.73 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-chlorophenyl)-N,5,6-trimethylpyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)-N,5,6-trimethylpyrimidin-4-amine?
The IUPAC name of 2-(3-chlorophenyl)-N,5,6-trimethylpyrimidin-4-amine (CID 55045730) is 2-(3-chlorophenyl)-N,5,6-trimethylpyrimidin-4-amine.
What is the SMILES notation for 2-(3-chlorophenyl)-N,5,6-trimethylpyrimidin-4-amine?
The canonical SMILES for 2-(3-chlorophenyl)-N,5,6-trimethylpyrimidin-4-amine is CNc1nc(-c2cccc(Cl)c2)nc(C)c1C.
What is the InChIKey of 2-(3-chlorophenyl)-N,5,6-trimethylpyrimidin-4-amine?
The InChIKey is RALMONBTPCWLMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14ClN3/c1-8-9(2)16-13(17-12(8)15-3)10-5-4-6-11(14)7-10/h4-7H,1-3H3,(H,15,16,17).
What are the key properties of 2-(3-chlorophenyl)-N,5,6-trimethylpyrimidin-4-amine?
2-(3-chlorophenyl)-N,5,6-trimethylpyrimidin-4-amine has a molecular weight of 247.73 g/mol, XLogP of 3.46, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)-N,5,6-trimethylpyrimidin-4-amine is sourced from PubChem (CID 55045730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).