C14H15FN2 — CID 55045940
5-fluoro-7-methyl-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 55045940) has the molecular formula C14H15FN2 and a molecular weight of 230.29 g/mol. Its IUPAC name is 5-fluoro-7-methyl-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | 5-fluoro-7-methyl-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 55045940 |
| Molecular Formula | C14H15FN2 |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 5-fluoro-7-methyl-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | Cc1cc(F)c2nc3c(c(N)c2c1)CCCC3 |
| InChI | InChI=1S/C14H15FN2/c1-8-6-10-13(16)9-4-2-3-5-12(9)17-14(10)11(15)7-8/h6-7H,2-5H2,1H3,(H2,16,17) |
| InChIKey | PMOXCGFIEHXSQK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |