About 4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-N-propylthiadiazol-5-amine
4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-N-propylthiadiazol-5-amine (PubChem CID 55046267) has the molecular formula C11H19F3N4S
and a molecular weight of 296.36 g/mol. Its IUPAC name is 4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-N-propylthiadiazol-5-amine.
Molecular Properties
| Compound Name | 4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-N-propylthiadiazol-5-amine |
| PubChem CID | 55046267 |
| Molecular Formula | C11H19F3N4S |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-N-propylthiadiazol-5-amine |
| SMILES | CCCNc1snnc1CN(CC(F)(F)F)C(C)C |
| InChI | InChI=1S/C11H19F3N4S/c1-4-5-15-10-9(16-17-19-10)6-18(8(2)3)7-11(12,13)14/h8,15H,4-7H2,1-3H3 |
| InChIKey | OQBIRMACGSWHCQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-N-propylthiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-N-propylthiadiazol-5-amine?
The IUPAC name of 4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-N-propylthiadiazol-5-amine (CID 55046267) is 4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-N-propylthiadiazol-5-amine.
What is the SMILES notation for 4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-N-propylthiadiazol-5-amine?
The canonical SMILES for 4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-N-propylthiadiazol-5-amine is CCCNc1snnc1CN(CC(F)(F)F)C(C)C.
What is the InChIKey of 4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-N-propylthiadiazol-5-amine?
The InChIKey is OQBIRMACGSWHCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19F3N4S/c1-4-5-15-10-9(16-17-19-10)6-18(8(2)3)7-11(12,13)14/h8,15H,4-7H2,1-3H3.
What are the key properties of 4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-N-propylthiadiazol-5-amine?
4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-N-propylthiadiazol-5-amine has a molecular weight of 296.36 g/mol, XLogP of 3.13, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]-N-propylthiadiazol-5-amine is sourced from PubChem (CID 55046267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).