C14H26N4S — CID 55046284
4-[[cyclohexylmethyl(methyl)amino]methyl]-N-propylthiadiazol-5-amine (PubChem CID 55046284) has the molecular formula C14H26N4S and a molecular weight of 282.46 g/mol. Its IUPAC name is 4-[[cyclohexylmethyl(methyl)amino]methyl]-N-propylthiadiazol-5-amine.
| Compound Name | 4-[[cyclohexylmethyl(methyl)amino]methyl]-N-propylthiadiazol-5-amine |
|---|---|
| PubChem CID | 55046284 |
| Molecular Formula | C14H26N4S |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 4-[[cyclohexylmethyl(methyl)amino]methyl]-N-propylthiadiazol-5-amine |
| SMILES | CCCNc1snnc1CN(C)CC1CCCCC1 |
| InChI | InChI=1S/C14H26N4S/c1-3-9-15-14-13(16-17-19-14)11-18(2)10-12-7-5-4-6-8-12/h12,15H,3-11H2,1-2H3 |
| InChIKey | IQOARYBWQJXRNQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |