About 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-N-ethylthiadiazol-5-amine
4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-N-ethylthiadiazol-5-amine (PubChem CID 55046458) has the molecular formula C10H18N4O2S2
and a molecular weight of 290.41 g/mol. Its IUPAC name is 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-N-ethylthiadiazol-5-amine.
Molecular Properties
| Compound Name | 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-N-ethylthiadiazol-5-amine |
| PubChem CID | 55046458 |
| Molecular Formula | C10H18N4O2S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-N-ethylthiadiazol-5-amine |
| SMILES | CCNc1snnc1CN(C)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C10H18N4O2S2/c1-3-11-10-9(12-13-17-10)6-14(2)8-4-5-18(15,16)7-8/h8,11H,3-7H2,1-2H3 |
| InChIKey | UTRWSIPBYBALJE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-N-ethylthiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-N-ethylthiadiazol-5-amine?
The IUPAC name of 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-N-ethylthiadiazol-5-amine (CID 55046458) is 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-N-ethylthiadiazol-5-amine.
What is the SMILES notation for 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-N-ethylthiadiazol-5-amine?
The canonical SMILES for 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-N-ethylthiadiazol-5-amine is CCNc1snnc1CN(C)C1CCS(=O)(=O)C1.
What is the InChIKey of 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-N-ethylthiadiazol-5-amine?
The InChIKey is UTRWSIPBYBALJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4O2S2/c1-3-11-10-9(12-13-17-10)6-14(2)8-4-5-18(15,16)7-8/h8,11H,3-7H2,1-2H3.
What are the key properties of 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-N-ethylthiadiazol-5-amine?
4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-N-ethylthiadiazol-5-amine has a molecular weight of 290.41 g/mol, XLogP of 0.59, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1,1-dioxothiolan-3-yl)-methylamino]methyl]-N-ethylthiadiazol-5-amine is sourced from PubChem (CID 55046458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).