About 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-methylamino]propanenitrile
3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-methylamino]propanenitrile (PubChem CID 55046681) has the molecular formula C11H13N5S
and a molecular weight of 247.33 g/mol. Its IUPAC name is 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-methylamino]propanenitrile.
Molecular Properties
| Compound Name | 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-methylamino]propanenitrile |
| PubChem CID | 55046681 |
| Molecular Formula | C11H13N5S |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-methylamino]propanenitrile |
| SMILES | CN(CCC#N)Cc1nc(N)c2ccsc2n1 |
| InChI | InChI=1S/C11H13N5S/c1-16(5-2-4-12)7-9-14-10(13)8-3-6-17-11(8)15-9/h3,6H,2,5,7H2,1H3,(H2,13,14,15) |
| InChIKey | NLTJLLDDBWNDIL-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 78.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-methylamino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-methylamino]propanenitrile?
The IUPAC name of 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-methylamino]propanenitrile (CID 55046681) is 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-methylamino]propanenitrile.
What is the SMILES notation for 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-methylamino]propanenitrile?
The canonical SMILES for 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-methylamino]propanenitrile is CN(CCC#N)Cc1nc(N)c2ccsc2n1.
What is the InChIKey of 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-methylamino]propanenitrile?
The InChIKey is NLTJLLDDBWNDIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5S/c1-16(5-2-4-12)7-9-14-10(13)8-3-6-17-11(8)15-9/h3,6H,2,5,7H2,1H3,(H2,13,14,15).
What are the key properties of 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-methylamino]propanenitrile?
3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-methylamino]propanenitrile has a molecular weight of 247.33 g/mol, XLogP of 1.62, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-aminothieno[2,3-d]pyrimidin-2-yl)methyl-methylamino]propanenitrile is sourced from PubChem (CID 55046681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).