About 2-thieno[3,2-b]thiophen-5-yl-5-(trifluoromethyl)-1,3,4-oxadiazole
2-thieno[3,2-b]thiophen-5-yl-5-(trifluoromethyl)-1,3,4-oxadiazole (PubChem CID 550467) has the molecular formula C9H3F3N2OS2
and a molecular weight of 276.26 g/mol. Its IUPAC name is 2-thieno[3,2-b]thiophen-5-yl-5-(trifluoromethyl)-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-thieno[3,2-b]thiophen-5-yl-5-(trifluoromethyl)-1,3,4-oxadiazole |
| PubChem CID | 550467 |
| Molecular Formula | C9H3F3N2OS2 |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 275.96 |
| IUPAC Name | 2-thieno[3,2-b]thiophen-5-yl-5-(trifluoromethyl)-1,3,4-oxadiazole |
| SMILES | FC(F)(F)c1nnc(-c2cc3sccc3s2)o1 |
| InChI | InChI=1S/C9H3F3N2OS2/c10-9(11,12)8-14-13-7(15-8)6-3-5-4(17-6)1-2-16-5/h1-3H |
| InChIKey | YIMCDRWAOJGISC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-thieno[3,2-b]thiophen-5-yl-5-(trifluoromethyl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-thieno[3,2-b]thiophen-5-yl-5-(trifluoromethyl)-1,3,4-oxadiazole?
The IUPAC name of 2-thieno[3,2-b]thiophen-5-yl-5-(trifluoromethyl)-1,3,4-oxadiazole (CID 550467) is 2-thieno[3,2-b]thiophen-5-yl-5-(trifluoromethyl)-1,3,4-oxadiazole.
What is the SMILES notation for 2-thieno[3,2-b]thiophen-5-yl-5-(trifluoromethyl)-1,3,4-oxadiazole?
The canonical SMILES for 2-thieno[3,2-b]thiophen-5-yl-5-(trifluoromethyl)-1,3,4-oxadiazole is FC(F)(F)c1nnc(-c2cc3sccc3s2)o1.
What is the InChIKey of 2-thieno[3,2-b]thiophen-5-yl-5-(trifluoromethyl)-1,3,4-oxadiazole?
The InChIKey is YIMCDRWAOJGISC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H3F3N2OS2/c10-9(11,12)8-14-13-7(15-8)6-3-5-4(17-6)1-2-16-5/h1-3H.
What are the key properties of 2-thieno[3,2-b]thiophen-5-yl-5-(trifluoromethyl)-1,3,4-oxadiazole?
2-thieno[3,2-b]thiophen-5-yl-5-(trifluoromethyl)-1,3,4-oxadiazole has a molecular weight of 276.26 g/mol, XLogP of 4.03, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-thieno[3,2-b]thiophen-5-yl-5-(trifluoromethyl)-1,3,4-oxadiazole is sourced from PubChem (CID 550467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).