C13H23NO4 — CID 55048092
methyl 4-methyl-2-(oxane-2-carbonylamino)pentanoate (PubChem CID 55048092) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is methyl 4-methyl-2-(oxane-2-carbonylamino)pentanoate.
| Compound Name | methyl 4-methyl-2-(oxane-2-carbonylamino)pentanoate |
|---|---|
| PubChem CID | 55048092 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | methyl 4-methyl-2-(oxane-2-carbonylamino)pentanoate |
| SMILES | COC(=O)C(CC(C)C)NC(=O)C1CCCCO1 |
| InChI | InChI=1S/C13H23NO4/c1-9(2)8-10(13(16)17-3)14-12(15)11-6-4-5-7-18-11/h9-11H,4-8H2,1-3H3,(H,14,15) |
| InChIKey | KUBNYMGSMOSOCH-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |