C7H16NO2P — CID 550490
N,N,5,5-tetramethyl-1,3,2-dioxaphosphinan-2-amine (PubChem CID 550490) has the molecular formula C7H16NO2P and a molecular weight of 177.18 g/mol. Its IUPAC name is N,N,5,5-tetramethyl-1,3,2-dioxaphosphinan-2-amine.
| Compound Name | N,N,5,5-tetramethyl-1,3,2-dioxaphosphinan-2-amine |
|---|---|
| PubChem CID | 550490 |
| Molecular Formula | C7H16NO2P |
| Molecular Weight | 177.18 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | N,N,5,5-tetramethyl-1,3,2-dioxaphosphinan-2-amine |
| SMILES | CN(C)P1OCC(C)(C)CO1 |
| InChI | InChI=1S/C7H16NO2P/c1-7(2)5-9-11(8(3)4)10-6-7/h5-6H2,1-4H3 |
| InChIKey | TZXGTTCMQKPZKT-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.18 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|