C16H18N2O — CID 55050236
4-[2-(1,3-dihydroisoindol-2-yl)ethoxy]aniline (PubChem CID 55050236) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-[2-(1,3-dihydroisoindol-2-yl)ethoxy]aniline.
| Compound Name | 4-[2-(1,3-dihydroisoindol-2-yl)ethoxy]aniline |
|---|---|
| PubChem CID | 55050236 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 4-[2-(1,3-dihydroisoindol-2-yl)ethoxy]aniline |
| SMILES | Nc1ccc(OCCN2Cc3ccccc3C2)cc1 |
| InChI | InChI=1S/C16H18N2O/c17-15-5-7-16(8-6-15)19-10-9-18-11-13-3-1-2-4-14(13)12-18/h1-8H,9-12,17H2 |
| InChIKey | RKZMCSHMNBAGNZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|