methyl 2-(2,4-dimethylphenyl)-1H-imidazole-5-carboxylate

C13H14N2O2 — CID 55050767

IUPACmethyl 2-(2,4-dimethylphenyl)-1H-imidazole-5-carboxylate
SMILESCOC(=O)c1cnc(-c2ccc(C)cc2C)[nH]1
InChIInChI=1S/C13H14N2O2/c1-8-4-5-10(9(2)6-8)12-14-7-11(15-12)13(16)17-3/h4-7H,1-3H3,(H,14,15)
InChIKeyZOTJMTJMPIETMA-UHFFFAOYSA-N
MW230.27 g/mol
LogP2.48
Rot. Bonds2

About methyl 2-(2,4-dimethylphenyl)-1H-imidazole-5-carboxylate

methyl 2-(2,4-dimethylphenyl)-1H-imidazole-5-carboxylate (PubChem CID 55050767) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is methyl 2-(2,4-dimethylphenyl)-1H-imidazole-5-carboxylate.

Molecular Properties

Compound Namemethyl 2-(2,4-dimethylphenyl)-1H-imidazole-5-carboxylate
PubChem CID55050767
Molecular FormulaC13H14N2O2
Molecular Weight230.27 g/mol
Exact Mass230.11
IUPAC Namemethyl 2-(2,4-dimethylphenyl)-1H-imidazole-5-carboxylate
SMILESCOC(=O)c1cnc(-c2ccc(C)cc2C)[nH]1
InChIInChI=1S/C13H14N2O2/c1-8-4-5-10(9(2)6-8)12-14-7-11(15-12)13(16)17-3/h4-7H,1-3H3,(H,14,15)
InChIKeyZOTJMTJMPIETMA-UHFFFAOYSA-N
XLogP2.48
TPSA54.98 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.27
LogP ≤ 52.48
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze methyl 2-(2,4-dimethylphenyl)-1H-imidazole-5-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(2,4-dimethylphenyl)-1H-imidazole-5-carboxylate?
The IUPAC name of methyl 2-(2,4-dimethylphenyl)-1H-imidazole-5-carboxylate (CID 55050767) is methyl 2-(2,4-dimethylphenyl)-1H-imidazole-5-carboxylate.
What is the SMILES notation for methyl 2-(2,4-dimethylphenyl)-1H-imidazole-5-carboxylate?
The canonical SMILES for methyl 2-(2,4-dimethylphenyl)-1H-imidazole-5-carboxylate is COC(=O)c1cnc(-c2ccc(C)cc2C)[nH]1.
What is the InChIKey of methyl 2-(2,4-dimethylphenyl)-1H-imidazole-5-carboxylate?
The InChIKey is ZOTJMTJMPIETMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N2O2/c1-8-4-5-10(9(2)6-8)12-14-7-11(15-12)13(16)17-3/h4-7H,1-3H3,(H,14,15).
What are the key properties of methyl 2-(2,4-dimethylphenyl)-1H-imidazole-5-carboxylate?
methyl 2-(2,4-dimethylphenyl)-1H-imidazole-5-carboxylate has a molecular weight of 230.27 g/mol, XLogP of 2.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2,4-dimethylphenyl)-1H-imidazole-5-carboxylate is sourced from PubChem (CID 55050767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).