About (6-amino-2-pyridinyl)-(2,2-dimethylmorpholin-4-yl)methanone
(6-amino-2-pyridinyl)-(2,2-dimethylmorpholin-4-yl)methanone (PubChem CID 55052527) has the molecular formula C12H17N3O2
and a molecular weight of 235.29 g/mol. Its IUPAC name is (6-amino-2-pyridinyl)-(2,2-dimethylmorpholin-4-yl)methanone.
Molecular Properties
| Compound Name | (6-amino-2-pyridinyl)-(2,2-dimethylmorpholin-4-yl)methanone |
| PubChem CID | 55052527 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | (6-amino-2-pyridinyl)-(2,2-dimethylmorpholin-4-yl)methanone |
| SMILES | CC1(C)CN(C(=O)c2cccc(N)n2)CCO1 |
| InChI | InChI=1S/C12H17N3O2/c1-12(2)8-15(6-7-17-12)11(16)9-4-3-5-10(13)14-9/h3-5H,6-8H2,1-2H3,(H2,13,14) |
| InChIKey | CNBXNAZYEQXJON-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-amino-2-pyridinyl)-(2,2-dimethylmorpholin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-amino-2-pyridinyl)-(2,2-dimethylmorpholin-4-yl)methanone?
The IUPAC name of (6-amino-2-pyridinyl)-(2,2-dimethylmorpholin-4-yl)methanone (CID 55052527) is (6-amino-2-pyridinyl)-(2,2-dimethylmorpholin-4-yl)methanone.
What is the SMILES notation for (6-amino-2-pyridinyl)-(2,2-dimethylmorpholin-4-yl)methanone?
The canonical SMILES for (6-amino-2-pyridinyl)-(2,2-dimethylmorpholin-4-yl)methanone is CC1(C)CN(C(=O)c2cccc(N)n2)CCO1.
What is the InChIKey of (6-amino-2-pyridinyl)-(2,2-dimethylmorpholin-4-yl)methanone?
The InChIKey is CNBXNAZYEQXJON-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O2/c1-12(2)8-15(6-7-17-12)11(16)9-4-3-5-10(13)14-9/h3-5H,6-8H2,1-2H3,(H2,13,14).
What are the key properties of (6-amino-2-pyridinyl)-(2,2-dimethylmorpholin-4-yl)methanone?
(6-amino-2-pyridinyl)-(2,2-dimethylmorpholin-4-yl)methanone has a molecular weight of 235.29 g/mol, XLogP of 0.91, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-amino-2-pyridinyl)-(2,2-dimethylmorpholin-4-yl)methanone is sourced from PubChem (CID 55052527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).