C11H15F3N4O — CID 55052558
6-hydrazinyl-N-propan-2-yl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide (PubChem CID 55052558) has the molecular formula C11H15F3N4O and a molecular weight of 276.26 g/mol. Its IUPAC name is 6-hydrazinyl-N-propan-2-yl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide.
| Compound Name | 6-hydrazinyl-N-propan-2-yl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 55052558 |
| Molecular Formula | C11H15F3N4O |
| Molecular Weight | 276.26 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 6-hydrazinyl-N-propan-2-yl-N-(2,2,2-trifluoroethyl)pyridine-2-carboxamide |
| SMILES | CC(C)N(CC(F)(F)F)C(=O)c1cccc(NN)n1 |
| InChI | InChI=1S/C11H15F3N4O/c1-7(2)18(6-11(12,13)14)10(19)8-4-3-5-9(16-8)17-15/h3-5,7H,6,15H2,1-2H3,(H,16,17) |
| InChIKey | CRNKFXBVQGCRNU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.26 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|