About 1-[(2,4-difluorophenyl)methyl]-6,7-dihydro-5H-indol-4-one
1-[(2,4-difluorophenyl)methyl]-6,7-dihydro-5H-indol-4-one (PubChem CID 55053043) has the molecular formula C15H13F2NO
and a molecular weight of 261.27 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-6,7-dihydro-5H-indol-4-one.
Molecular Properties
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-6,7-dihydro-5H-indol-4-one |
| PubChem CID | 55053043 |
| Molecular Formula | C15H13F2NO |
| Molecular Weight | 261.27 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-6,7-dihydro-5H-indol-4-one |
| SMILES | O=C1CCCc2c1ccn2Cc1ccc(F)cc1F |
| InChI | InChI=1S/C15H13F2NO/c16-11-5-4-10(13(17)8-11)9-18-7-6-12-14(18)2-1-3-15(12)19/h4-8H,1-3,9H2 |
| InChIKey | USZIGKUAUOWISL-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.27 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2,4-difluorophenyl)methyl]-6,7-dihydro-5H-indol-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-difluorophenyl)methyl]-6,7-dihydro-5H-indol-4-one?
The IUPAC name of 1-[(2,4-difluorophenyl)methyl]-6,7-dihydro-5H-indol-4-one (CID 55053043) is 1-[(2,4-difluorophenyl)methyl]-6,7-dihydro-5H-indol-4-one.
What is the SMILES notation for 1-[(2,4-difluorophenyl)methyl]-6,7-dihydro-5H-indol-4-one?
The canonical SMILES for 1-[(2,4-difluorophenyl)methyl]-6,7-dihydro-5H-indol-4-one is O=C1CCCc2c1ccn2Cc1ccc(F)cc1F.
What is the InChIKey of 1-[(2,4-difluorophenyl)methyl]-6,7-dihydro-5H-indol-4-one?
The InChIKey is USZIGKUAUOWISL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F2NO/c16-11-5-4-10(13(17)8-11)9-18-7-6-12-14(18)2-1-3-15(12)19/h4-8H,1-3,9H2.
What are the key properties of 1-[(2,4-difluorophenyl)methyl]-6,7-dihydro-5H-indol-4-one?
1-[(2,4-difluorophenyl)methyl]-6,7-dihydro-5H-indol-4-one has a molecular weight of 261.27 g/mol, XLogP of 3.33, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-difluorophenyl)methyl]-6,7-dihydro-5H-indol-4-one is sourced from PubChem (CID 55053043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).