About [2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-(trifluoromethyl)phenyl]methanamine
[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-(trifluoromethyl)phenyl]methanamine (PubChem CID 55053447) has the molecular formula C11H10F3N3OS
and a molecular weight of 289.28 g/mol. Its IUPAC name is [2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-(trifluoromethyl)phenyl]methanamine.
Molecular Properties
| Compound Name | [2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-(trifluoromethyl)phenyl]methanamine |
| PubChem CID | 55053447 |
| Molecular Formula | C11H10F3N3OS |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | [2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-(trifluoromethyl)phenyl]methanamine |
| SMILES | Cc1nnc(Sc2ccc(C(F)(F)F)cc2CN)o1 |
| InChI | InChI=1S/C11H10F3N3OS/c1-6-16-17-10(18-6)19-9-3-2-8(11(12,13)14)4-7(9)5-15/h2-4H,5,15H2,1H3 |
| InChIKey | BLRHAUMWSHFEBQ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-(trifluoromethyl)phenyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-(trifluoromethyl)phenyl]methanamine?
The IUPAC name of [2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-(trifluoromethyl)phenyl]methanamine (CID 55053447) is [2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-(trifluoromethyl)phenyl]methanamine.
What is the SMILES notation for [2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-(trifluoromethyl)phenyl]methanamine?
The canonical SMILES for [2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-(trifluoromethyl)phenyl]methanamine is Cc1nnc(Sc2ccc(C(F)(F)F)cc2CN)o1.
What is the InChIKey of [2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-(trifluoromethyl)phenyl]methanamine?
The InChIKey is BLRHAUMWSHFEBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3N3OS/c1-6-16-17-10(18-6)19-9-3-2-8(11(12,13)14)4-7(9)5-15/h2-4H,5,15H2,1H3.
What are the key properties of [2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-(trifluoromethyl)phenyl]methanamine?
[2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-(trifluoromethyl)phenyl]methanamine has a molecular weight of 289.28 g/mol, XLogP of 3.01, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(5-methyl-1,3,4-oxadiazol-2-yl)sulfanyl]-5-(trifluoromethyl)phenyl]methanamine is sourced from PubChem (CID 55053447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).