C15H15NO3 — CID 55054315
5-(3,4-dihydro-2H-quinolin-1-ylmethyl)furan-3-carboxylic acid (PubChem CID 55054315) has the molecular formula C15H15NO3 and a molecular weight of 257.29 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-quinolin-1-ylmethyl)furan-3-carboxylic acid.
| Compound Name | 5-(3,4-dihydro-2H-quinolin-1-ylmethyl)furan-3-carboxylic acid |
|---|---|
| PubChem CID | 55054315 |
| Molecular Formula | C15H15NO3 |
| Molecular Weight | 257.29 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 5-(3,4-dihydro-2H-quinolin-1-ylmethyl)furan-3-carboxylic acid |
| SMILES | O=C(O)c1coc(CN2CCCc3ccccc32)c1 |
| InChI | InChI=1S/C15H15NO3/c17-15(18)12-8-13(19-10-12)9-16-7-3-5-11-4-1-2-6-14(11)16/h1-2,4,6,8,10H,3,5,7,9H2,(H,17,18) |
| InChIKey | SKFHMIVPZCILPT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |