C13H22BrN3 — CID 55054995
5-bromo-3-(methylaminomethyl)-N,N-dipropylpyridin-2-amine (PubChem CID 55054995) has the molecular formula C13H22BrN3 and a molecular weight of 300.24 g/mol. Its IUPAC name is 5-bromo-3-(methylaminomethyl)-N,N-dipropylpyridin-2-amine.
| Compound Name | 5-bromo-3-(methylaminomethyl)-N,N-dipropylpyridin-2-amine |
|---|---|
| PubChem CID | 55054995 |
| Molecular Formula | C13H22BrN3 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 5-bromo-3-(methylaminomethyl)-N,N-dipropylpyridin-2-amine |
| SMILES | CCCN(CCC)c1ncc(Br)cc1CNC |
| InChI | InChI=1S/C13H22BrN3/c1-4-6-17(7-5-2)13-11(9-15-3)8-12(14)10-16-13/h8,10,15H,4-7,9H2,1-3H3 |
| InChIKey | VGSRYULIDCGYJK-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |