C16H25N3 — CID 55055081
2-[(tert-butylamino)methyl]-N,N-bis(prop-2-enyl)pyridin-4-amine (PubChem CID 55055081) has the molecular formula C16H25N3 and a molecular weight of 259.40 g/mol. Its IUPAC name is 2-[(tert-butylamino)methyl]-N,N-bis(prop-2-enyl)pyridin-4-amine.
| Compound Name | 2-[(tert-butylamino)methyl]-N,N-bis(prop-2-enyl)pyridin-4-amine |
|---|---|
| PubChem CID | 55055081 |
| Molecular Formula | C16H25N3 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.20 |
| IUPAC Name | 2-[(tert-butylamino)methyl]-N,N-bis(prop-2-enyl)pyridin-4-amine |
| SMILES | C=CCN(CC=C)c1ccnc(CNC(C)(C)C)c1 |
| InChI | InChI=1S/C16H25N3/c1-6-10-19(11-7-2)15-8-9-17-14(12-15)13-18-16(3,4)5/h6-9,12,18H,1-2,10-11,13H2,3-5H3 |
| InChIKey | RDDABBFXAAPDPJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|