C14H18N2O — CID 55055284
(7-amino-3,4-dihydro-2H-quinolin-1-yl)-cyclobutylmethanone (PubChem CID 55055284) has the molecular formula C14H18N2O and a molecular weight of 230.31 g/mol. Its IUPAC name is (7-amino-3,4-dihydro-2H-quinolin-1-yl)-cyclobutylmethanone.
| Compound Name | (7-amino-3,4-dihydro-2H-quinolin-1-yl)-cyclobutylmethanone |
|---|---|
| PubChem CID | 55055284 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | (7-amino-3,4-dihydro-2H-quinolin-1-yl)-cyclobutylmethanone |
| SMILES | Nc1ccc2c(c1)N(C(=O)C1CCC1)CCC2 |
| InChI | InChI=1S/C14H18N2O/c15-12-7-6-10-5-2-8-16(13(10)9-12)14(17)11-3-1-4-11/h6-7,9,11H,1-5,8,15H2 |
| InChIKey | TUTPHPQBAHFMSF-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|