C14H29F3N2 — CID 55056324
2-ethyl-2-methyl-N,N'-dipropyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine (PubChem CID 55056324) has the molecular formula C14H29F3N2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-ethyl-2-methyl-N,N'-dipropyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine.
| Compound Name | 2-ethyl-2-methyl-N,N'-dipropyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 55056324 |
| Molecular Formula | C14H29F3N2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 2-ethyl-2-methyl-N,N'-dipropyl-N'-(2,2,2-trifluoroethyl)propane-1,3-diamine |
| SMILES | CCCNCC(C)(CC)CN(CCC)CC(F)(F)F |
| InChI | InChI=1S/C14H29F3N2/c1-5-8-18-10-13(4,7-3)11-19(9-6-2)12-14(15,16)17/h18H,5-12H2,1-4H3 |
| InChIKey | PJXGQBNXFBLBTO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|