C20H21NOS — CID 5506
View drug profile → tolciclateO-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl) N-methyl-N-(3-methylphenyl)carbamothioate (PubChem CID 5506) has the molecular formula C20H21NOS and a molecular weight of 323.46 g/mol. Its IUPAC name is O-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl) N-methyl-N-(3-methylphenyl)carbamothioate.
| Compound Name | O-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl) N-methyl-N-(3-methylphenyl)carbamothioate |
|---|---|
| PubChem CID | 5506 |
| Molecular Formula | C20H21NOS |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | O-(4-tricyclo[6.2.1.02,7]undeca-2(7),3,5-trienyl) N-methyl-N-(3-methylphenyl)carbamothioate |
| SMILES | Cc1cccc(N(C)C(=S)Oc2ccc3c(c2)C2CCC3C2)c1 |
| InChI | InChI=1S/C20H21NOS/c1-13-4-3-5-16(10-13)21(2)20(23)22-17-8-9-18-14-6-7-15(11-14)19(18)12-17/h3-5,8-10,12,14-15H,6-7,11H2,1-2H3 |
| InChIKey | CANCCLAKQQHLNK-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|