C10H13Cl2NO3S — CID 55060829
2,3-dichloro-N-(2-hydroxypropyl)-N-methylbenzenesulfonamide (PubChem CID 55060829) has the molecular formula C10H13Cl2NO3S and a molecular weight of 298.19 g/mol. Its IUPAC name is 2,3-dichloro-N-(2-hydroxypropyl)-N-methylbenzenesulfonamide.
| Compound Name | 2,3-dichloro-N-(2-hydroxypropyl)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 55060829 |
| Molecular Formula | C10H13Cl2NO3S |
| Molecular Weight | 298.19 g/mol |
| Exact Mass | 297.00 |
| IUPAC Name | 2,3-dichloro-N-(2-hydroxypropyl)-N-methylbenzenesulfonamide |
| SMILES | CC(O)CN(C)S(=O)(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C10H13Cl2NO3S/c1-7(14)6-13(2)17(15,16)9-5-3-4-8(11)10(9)12/h3-5,7,14H,6H2,1-2H3 |
| InChIKey | URJUGBWVPFVHHO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |