About 2-(5-ethylfuran-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine
2-(5-ethylfuran-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (PubChem CID 55061398) has the molecular formula C13H15N3O
and a molecular weight of 229.28 g/mol. Its IUPAC name is 2-(5-ethylfuran-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(5-ethylfuran-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| PubChem CID | 55061398 |
| Molecular Formula | C13H15N3O |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 2-(5-ethylfuran-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine |
| SMILES | CCc1ccc(-c2nc(N)c3c(n2)CCC3)o1 |
| InChI | InChI=1S/C13H15N3O/c1-2-8-6-7-11(17-8)13-15-10-5-3-4-9(10)12(14)16-13/h6-7H,2-5H2,1H3,(H2,14,15,16) |
| InChIKey | PMDXYBWXSXFMTH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-ethylfuran-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-ethylfuran-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The IUPAC name of 2-(5-ethylfuran-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine (CID 55061398) is 2-(5-ethylfuran-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine.
What is the SMILES notation for 2-(5-ethylfuran-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The canonical SMILES for 2-(5-ethylfuran-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine is CCc1ccc(-c2nc(N)c3c(n2)CCC3)o1.
What is the InChIKey of 2-(5-ethylfuran-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
The InChIKey is PMDXYBWXSXFMTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N3O/c1-2-8-6-7-11(17-8)13-15-10-5-3-4-9(10)12(14)16-13/h6-7H,2-5H2,1H3,(H2,14,15,16).
What are the key properties of 2-(5-ethylfuran-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine?
2-(5-ethylfuran-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine has a molecular weight of 229.28 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-ethylfuran-2-yl)-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-amine is sourced from PubChem (CID 55061398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).