C12H12ClF3O — CID 55061822
5-(1-chloro-2,2,2-trifluoroethyl)-2,2-dimethyl-3H-1-benzofuran (PubChem CID 55061822) has the molecular formula C12H12ClF3O and a molecular weight of 264.67 g/mol. Its IUPAC name is 5-(1-chloro-2,2,2-trifluoroethyl)-2,2-dimethyl-3H-1-benzofuran.
| Compound Name | 5-(1-chloro-2,2,2-trifluoroethyl)-2,2-dimethyl-3H-1-benzofuran |
|---|---|
| PubChem CID | 55061822 |
| Molecular Formula | C12H12ClF3O |
| Molecular Weight | 264.67 g/mol |
| Exact Mass | 264.05 |
| IUPAC Name | 5-(1-chloro-2,2,2-trifluoroethyl)-2,2-dimethyl-3H-1-benzofuran |
| SMILES | CC1(C)Cc2cc(C(Cl)C(F)(F)F)ccc2O1 |
| InChI | InChI=1S/C12H12ClF3O/c1-11(2)6-8-5-7(3-4-9(8)17-11)10(13)12(14,15)16/h3-5,10H,6H2,1-2H3 |
| InChIKey | UFARQTUUECZYND-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.67 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|