C16H24N2 — CID 55061951
3-(2,4-dimethylpiperidin-1-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 55061951) has the molecular formula C16H24N2 and a molecular weight of 244.38 g/mol. Its IUPAC name is 3-(2,4-dimethylpiperidin-1-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 3-(2,4-dimethylpiperidin-1-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 55061951 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 3-(2,4-dimethylpiperidin-1-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1CCN(C2CNc3ccccc3C2)C(C)C1 |
| InChI | InChI=1S/C16H24N2/c1-12-7-8-18(13(2)9-12)15-10-14-5-3-4-6-16(14)17-11-15/h3-6,12-13,15,17H,7-11H2,1-2H3 |
| InChIKey | JAXWMVGTGLZHQU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |