C15H14F12N4O2 — CID 550625
N-cyclohexyl-4,6-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-amine (PubChem CID 550625) has the molecular formula C15H14F12N4O2 and a molecular weight of 510.28 g/mol. Its IUPAC name is N-cyclohexyl-4,6-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-amine.
| Compound Name | N-cyclohexyl-4,6-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 550625 |
| Molecular Formula | C15H14F12N4O2 |
| Molecular Weight | 510.28 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | N-cyclohexyl-4,6-bis(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-1,3,5-triazin-2-amine |
| SMILES | FC(F)(F)C(Oc1nc(NC2CCCCC2)nc(OC(C(F)(F)F)C(F)(F)F)n1)C(F)(F)F |
| InChI | InChI=1S/C15H14F12N4O2/c16-12(17,18)7(13(19,20)21)32-10-29-9(28-6-4-2-1-3-5-6)30-11(31-10)33-8(14(22,23)24)15(25,26)27/h6-8H,1-5H2,(H,28,29,30,31) |
| InChIKey | UQVWQMUXDAUZHO-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.28 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |