About N-(4-aminocyclohexyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide
N-(4-aminocyclohexyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide (PubChem CID 55062584) has the molecular formula C12H20N4O
and a molecular weight of 236.32 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(4-aminocyclohexyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide |
| PubChem CID | 55062584 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | N-(4-aminocyclohexyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide |
| SMILES | Cc1n[nH]c(C)c1C(=O)NC1CCC(N)CC1 |
| InChI | InChI=1S/C12H20N4O/c1-7-11(8(2)16-15-7)12(17)14-10-5-3-9(13)4-6-10/h9-10H,3-6,13H2,1-2H3,(H,14,17)(H,15,16) |
| InChIKey | YRNUAJSPJVWZHE-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-aminocyclohexyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-aminocyclohexyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide?
The IUPAC name of N-(4-aminocyclohexyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide (CID 55062584) is N-(4-aminocyclohexyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide.
What is the SMILES notation for N-(4-aminocyclohexyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide?
The canonical SMILES for N-(4-aminocyclohexyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide is Cc1n[nH]c(C)c1C(=O)NC1CCC(N)CC1.
What is the InChIKey of N-(4-aminocyclohexyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide?
The InChIKey is YRNUAJSPJVWZHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N4O/c1-7-11(8(2)16-15-7)12(17)14-10-5-3-9(13)4-6-10/h9-10H,3-6,13H2,1-2H3,(H,14,17)(H,15,16).
What are the key properties of N-(4-aminocyclohexyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide?
N-(4-aminocyclohexyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide has a molecular weight of 236.32 g/mol, XLogP of 1.03, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-aminocyclohexyl)-3,5-dimethyl-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 55062584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).