About 2-(methoxymethyl)-6-N,6-N-dimethylquinoline-4,6-diamine
2-(methoxymethyl)-6-N,6-N-dimethylquinoline-4,6-diamine (PubChem CID 55062590) has the molecular formula C13H17N3O
and a molecular weight of 231.30 g/mol. Its IUPAC name is 2-(methoxymethyl)-6-N,6-N-dimethylquinoline-4,6-diamine.
Molecular Properties
| Compound Name | 2-(methoxymethyl)-6-N,6-N-dimethylquinoline-4,6-diamine |
| PubChem CID | 55062590 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 2-(methoxymethyl)-6-N,6-N-dimethylquinoline-4,6-diamine |
| SMILES | COCc1cc(N)c2cc(N(C)C)ccc2n1 |
| InChI | InChI=1S/C13H17N3O/c1-16(2)10-4-5-13-11(7-10)12(14)6-9(15-13)8-17-3/h4-7H,8H2,1-3H3,(H2,14,15) |
| InChIKey | FOQYTKNVCBRGBN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(methoxymethyl)-6-N,6-N-dimethylquinoline-4,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methoxymethyl)-6-N,6-N-dimethylquinoline-4,6-diamine?
The IUPAC name of 2-(methoxymethyl)-6-N,6-N-dimethylquinoline-4,6-diamine (CID 55062590) is 2-(methoxymethyl)-6-N,6-N-dimethylquinoline-4,6-diamine.
What is the SMILES notation for 2-(methoxymethyl)-6-N,6-N-dimethylquinoline-4,6-diamine?
The canonical SMILES for 2-(methoxymethyl)-6-N,6-N-dimethylquinoline-4,6-diamine is COCc1cc(N)c2cc(N(C)C)ccc2n1.
What is the InChIKey of 2-(methoxymethyl)-6-N,6-N-dimethylquinoline-4,6-diamine?
The InChIKey is FOQYTKNVCBRGBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O/c1-16(2)10-4-5-13-11(7-10)12(14)6-9(15-13)8-17-3/h4-7H,8H2,1-3H3,(H2,14,15).
What are the key properties of 2-(methoxymethyl)-6-N,6-N-dimethylquinoline-4,6-diamine?
2-(methoxymethyl)-6-N,6-N-dimethylquinoline-4,6-diamine has a molecular weight of 231.30 g/mol, XLogP of 2.03, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methoxymethyl)-6-N,6-N-dimethylquinoline-4,6-diamine is sourced from PubChem (CID 55062590), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).