C11H9Br2F3N2O — CID 55063087
5-bromo-6-(1-bromo-2,2,2-trifluoroethyl)-1,3-dimethylbenzimidazol-2-one (PubChem CID 55063087) has the molecular formula C11H9Br2F3N2O and a molecular weight of 402.01 g/mol. Its IUPAC name is 5-bromo-6-(1-bromo-2,2,2-trifluoroethyl)-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-bromo-6-(1-bromo-2,2,2-trifluoroethyl)-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 55063087 |
| Molecular Formula | C11H9Br2F3N2O |
| Molecular Weight | 402.01 g/mol |
| Exact Mass | 399.90 |
| IUPAC Name | 5-bromo-6-(1-bromo-2,2,2-trifluoroethyl)-1,3-dimethylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(C(Br)C(F)(F)F)c(Br)cc21 |
| InChI | InChI=1S/C11H9Br2F3N2O/c1-17-7-3-5(9(13)11(14,15)16)6(12)4-8(7)18(2)10(17)19/h3-4,9H,1-2H3 |
| InChIKey | MXLOWSQGLGNORP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.01 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|