About ethyl 2-(prop-2-ynylamino)-1,3-dihydroindene-2-carboxylate
ethyl 2-(prop-2-ynylamino)-1,3-dihydroindene-2-carboxylate (PubChem CID 55063107) has the molecular formula C15H17NO2
and a molecular weight of 243.31 g/mol. Its IUPAC name is ethyl 2-(prop-2-ynylamino)-1,3-dihydroindene-2-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-(prop-2-ynylamino)-1,3-dihydroindene-2-carboxylate |
| PubChem CID | 55063107 |
| Molecular Formula | C15H17NO2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | ethyl 2-(prop-2-ynylamino)-1,3-dihydroindene-2-carboxylate |
| SMILES | C#CCNC1(C(=O)OCC)Cc2ccccc2C1 |
| InChI | InChI=1S/C15H17NO2/c1-3-9-16-15(14(17)18-4-2)10-12-7-5-6-8-13(12)11-15/h1,5-8,16H,4,9-11H2,2H3 |
| InChIKey | BXDDBAKXMZQWQM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-(prop-2-ynylamino)-1,3-dihydroindene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(prop-2-ynylamino)-1,3-dihydroindene-2-carboxylate?
The IUPAC name of ethyl 2-(prop-2-ynylamino)-1,3-dihydroindene-2-carboxylate (CID 55063107) is ethyl 2-(prop-2-ynylamino)-1,3-dihydroindene-2-carboxylate.
What is the SMILES notation for ethyl 2-(prop-2-ynylamino)-1,3-dihydroindene-2-carboxylate?
The canonical SMILES for ethyl 2-(prop-2-ynylamino)-1,3-dihydroindene-2-carboxylate is C#CCNC1(C(=O)OCC)Cc2ccccc2C1.
What is the InChIKey of ethyl 2-(prop-2-ynylamino)-1,3-dihydroindene-2-carboxylate?
The InChIKey is BXDDBAKXMZQWQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NO2/c1-3-9-16-15(14(17)18-4-2)10-12-7-5-6-8-13(12)11-15/h1,5-8,16H,4,9-11H2,2H3.
What are the key properties of ethyl 2-(prop-2-ynylamino)-1,3-dihydroindene-2-carboxylate?
ethyl 2-(prop-2-ynylamino)-1,3-dihydroindene-2-carboxylate has a molecular weight of 243.31 g/mol, XLogP of 1.31, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(prop-2-ynylamino)-1,3-dihydroindene-2-carboxylate is sourced from PubChem (CID 55063107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).