C12H17N3O4 — CID 55063979
2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(2-hydroxycyclohexyl)acetamide (PubChem CID 55063979) has the molecular formula C12H17N3O4 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(2-hydroxycyclohexyl)acetamide.
| Compound Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(2-hydroxycyclohexyl)acetamide |
|---|---|
| PubChem CID | 55063979 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 2-(3,6-dioxo-1H-pyridazin-2-yl)-N-(2-hydroxycyclohexyl)acetamide |
| SMILES | O=C(Cn1[nH]c(=O)ccc1=O)NC1CCCCC1O |
| InChI | InChI=1S/C12H17N3O4/c16-9-4-2-1-3-8(9)13-11(18)7-15-12(19)6-5-10(17)14-15/h5-6,8-9,16H,1-4,7H2,(H,13,18)(H,14,17) |
| InChIKey | XYOTVJJPYASIPT-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 104.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |