About 2-[(N'-cyclohexylcarbamimidoyl)amino]-N-propylpropanamide
2-[(N'-cyclohexylcarbamimidoyl)amino]-N-propylpropanamide (PubChem CID 55064162) has the molecular formula C13H26N4O
and a molecular weight of 254.38 g/mol. Its IUPAC name is 2-[(N'-cyclohexylcarbamimidoyl)amino]-N-propylpropanamide.
Molecular Properties
| Compound Name | 2-[(N'-cyclohexylcarbamimidoyl)amino]-N-propylpropanamide |
| PubChem CID | 55064162 |
| Molecular Formula | C13H26N4O |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | 2-[(N'-cyclohexylcarbamimidoyl)amino]-N-propylpropanamide |
| SMILES | CCCNC(=O)C(C)N/C(N)=N/C1CCCCC1 |
| InChI | InChI=1S/C13H26N4O/c1-3-9-15-12(18)10(2)16-13(14)17-11-7-5-4-6-8-11/h10-11H,3-9H2,1-2H3,(H,15,18)(H3,14,16,17) |
| InChIKey | CURQSCZUYBTLMY-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(N'-cyclohexylcarbamimidoyl)amino]-N-propylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(N'-cyclohexylcarbamimidoyl)amino]-N-propylpropanamide?
The IUPAC name of 2-[(N'-cyclohexylcarbamimidoyl)amino]-N-propylpropanamide (CID 55064162) is 2-[(N'-cyclohexylcarbamimidoyl)amino]-N-propylpropanamide.
What is the SMILES notation for 2-[(N'-cyclohexylcarbamimidoyl)amino]-N-propylpropanamide?
The canonical SMILES for 2-[(N'-cyclohexylcarbamimidoyl)amino]-N-propylpropanamide is CCCNC(=O)C(C)N/C(N)=N/C1CCCCC1.
What is the InChIKey of 2-[(N'-cyclohexylcarbamimidoyl)amino]-N-propylpropanamide?
The InChIKey is CURQSCZUYBTLMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N4O/c1-3-9-15-12(18)10(2)16-13(14)17-11-7-5-4-6-8-11/h10-11H,3-9H2,1-2H3,(H,15,18)(H3,14,16,17).
What are the key properties of 2-[(N'-cyclohexylcarbamimidoyl)amino]-N-propylpropanamide?
2-[(N'-cyclohexylcarbamimidoyl)amino]-N-propylpropanamide has a molecular weight of 254.38 g/mol, XLogP of 1.14, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(N'-cyclohexylcarbamimidoyl)amino]-N-propylpropanamide is sourced from PubChem (CID 55064162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).