C16H29N3 — CID 55064197
N'-cyclohexyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboximidamide (PubChem CID 55064197) has the molecular formula C16H29N3 and a molecular weight of 263.43 g/mol. Its IUPAC name is N'-cyclohexyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N'-cyclohexyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 55064197 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | N'-cyclohexyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinoline-2-carboximidamide |
| SMILES | N/C(=N\C1CCCCC1)N1CCC2CCCCC2C1 |
| InChI | InChI=1S/C16H29N3/c17-16(18-15-8-2-1-3-9-15)19-11-10-13-6-4-5-7-14(13)12-19/h13-15H,1-12H2,(H2,17,18) |
| InChIKey | BMOCTBPWKQCVCM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|