About 4-[(4,5-dimethylimidazol-1-yl)methyl]-N-propylthiadiazol-5-amine
4-[(4,5-dimethylimidazol-1-yl)methyl]-N-propylthiadiazol-5-amine (PubChem CID 55065032) has the molecular formula C11H17N5S
and a molecular weight of 251.36 g/mol. Its IUPAC name is 4-[(4,5-dimethylimidazol-1-yl)methyl]-N-propylthiadiazol-5-amine.
Molecular Properties
| Compound Name | 4-[(4,5-dimethylimidazol-1-yl)methyl]-N-propylthiadiazol-5-amine |
| PubChem CID | 55065032 |
| Molecular Formula | C11H17N5S |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 4-[(4,5-dimethylimidazol-1-yl)methyl]-N-propylthiadiazol-5-amine |
| SMILES | CCCNc1snnc1Cn1cnc(C)c1C |
| InChI | InChI=1S/C11H17N5S/c1-4-5-12-11-10(14-15-17-11)6-16-7-13-8(2)9(16)3/h7,12H,4-6H2,1-3H3 |
| InChIKey | WZJIPFDXGMUNMY-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-[(4,5-dimethylimidazol-1-yl)methyl]-N-propylthiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4,5-dimethylimidazol-1-yl)methyl]-N-propylthiadiazol-5-amine?
The IUPAC name of 4-[(4,5-dimethylimidazol-1-yl)methyl]-N-propylthiadiazol-5-amine (CID 55065032) is 4-[(4,5-dimethylimidazol-1-yl)methyl]-N-propylthiadiazol-5-amine.
What is the SMILES notation for 4-[(4,5-dimethylimidazol-1-yl)methyl]-N-propylthiadiazol-5-amine?
The canonical SMILES for 4-[(4,5-dimethylimidazol-1-yl)methyl]-N-propylthiadiazol-5-amine is CCCNc1snnc1Cn1cnc(C)c1C.
What is the InChIKey of 4-[(4,5-dimethylimidazol-1-yl)methyl]-N-propylthiadiazol-5-amine?
The InChIKey is WZJIPFDXGMUNMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N5S/c1-4-5-12-11-10(14-15-17-11)6-16-7-13-8(2)9(16)3/h7,12H,4-6H2,1-3H3.
What are the key properties of 4-[(4,5-dimethylimidazol-1-yl)methyl]-N-propylthiadiazol-5-amine?
4-[(4,5-dimethylimidazol-1-yl)methyl]-N-propylthiadiazol-5-amine has a molecular weight of 251.36 g/mol, XLogP of 2.22, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4,5-dimethylimidazol-1-yl)methyl]-N-propylthiadiazol-5-amine is sourced from PubChem (CID 55065032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).