C13H26N2O2 — CID 55065440
N,N-dimethyl-4-(2-piperidin-2-ylethoxy)butanamide (PubChem CID 55065440) has the molecular formula C13H26N2O2 and a molecular weight of 242.36 g/mol. Its IUPAC name is N,N-dimethyl-4-(2-piperidin-2-ylethoxy)butanamide.
| Compound Name | N,N-dimethyl-4-(2-piperidin-2-ylethoxy)butanamide |
|---|---|
| PubChem CID | 55065440 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | N,N-dimethyl-4-(2-piperidin-2-ylethoxy)butanamide |
| SMILES | CN(C)C(=O)CCCOCCC1CCCCN1 |
| InChI | InChI=1S/C13H26N2O2/c1-15(2)13(16)7-5-10-17-11-8-12-6-3-4-9-14-12/h12,14H,3-11H2,1-2H3 |
| InChIKey | YOHLMLGTHNXQQB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|