About 2-(oxan-4-ylmethyl)-2,3-dihydroinden-1-one
2-(oxan-4-ylmethyl)-2,3-dihydroinden-1-one (PubChem CID 55066215) has the molecular formula C15H18O2
and a molecular weight of 230.31 g/mol. Its IUPAC name is 2-(oxan-4-ylmethyl)-2,3-dihydroinden-1-one.
Molecular Properties
| Compound Name | 2-(oxan-4-ylmethyl)-2,3-dihydroinden-1-one |
| PubChem CID | 55066215 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-(oxan-4-ylmethyl)-2,3-dihydroinden-1-one |
| SMILES | O=C1c2ccccc2CC1CC1CCOCC1 |
| InChI | InChI=1S/C15H18O2/c16-15-13(9-11-5-7-17-8-6-11)10-12-3-1-2-4-14(12)15/h1-4,11,13H,5-10H2 |
| InChIKey | CXGYOFYXLAATAU-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(oxan-4-ylmethyl)-2,3-dihydroinden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxan-4-ylmethyl)-2,3-dihydroinden-1-one?
The IUPAC name of 2-(oxan-4-ylmethyl)-2,3-dihydroinden-1-one (CID 55066215) is 2-(oxan-4-ylmethyl)-2,3-dihydroinden-1-one.
What is the SMILES notation for 2-(oxan-4-ylmethyl)-2,3-dihydroinden-1-one?
The canonical SMILES for 2-(oxan-4-ylmethyl)-2,3-dihydroinden-1-one is O=C1c2ccccc2CC1CC1CCOCC1.
What is the InChIKey of 2-(oxan-4-ylmethyl)-2,3-dihydroinden-1-one?
The InChIKey is CXGYOFYXLAATAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O2/c16-15-13(9-11-5-7-17-8-6-11)10-12-3-1-2-4-14(12)15/h1-4,11,13H,5-10H2.
What are the key properties of 2-(oxan-4-ylmethyl)-2,3-dihydroinden-1-one?
2-(oxan-4-ylmethyl)-2,3-dihydroinden-1-one has a molecular weight of 230.31 g/mol, XLogP of 2.86, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxan-4-ylmethyl)-2,3-dihydroinden-1-one is sourced from PubChem (CID 55066215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).