About N-[[4-(aminomethyl)oxan-4-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine
N-[[4-(aminomethyl)oxan-4-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine (PubChem CID 55066527) has the molecular formula C11H21F3N2O
and a molecular weight of 254.30 g/mol. Its IUPAC name is N-[[4-(aminomethyl)oxan-4-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine.
Molecular Properties
| Compound Name | N-[[4-(aminomethyl)oxan-4-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine |
| PubChem CID | 55066527 |
| Molecular Formula | C11H21F3N2O |
| Molecular Weight | 254.30 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | N-[[4-(aminomethyl)oxan-4-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine |
| SMILES | CCN(CC(F)(F)F)CC1(CN)CCOCC1 |
| InChI | InChI=1S/C11H21F3N2O/c1-2-16(9-11(12,13)14)8-10(7-15)3-5-17-6-4-10/h2-9,15H2,1H3 |
| InChIKey | CKWWPMSALBWPTE-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.30 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[4-(aminomethyl)oxan-4-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[4-(aminomethyl)oxan-4-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine?
The IUPAC name of N-[[4-(aminomethyl)oxan-4-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine (CID 55066527) is N-[[4-(aminomethyl)oxan-4-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine.
What is the SMILES notation for N-[[4-(aminomethyl)oxan-4-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine?
The canonical SMILES for N-[[4-(aminomethyl)oxan-4-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine is CCN(CC(F)(F)F)CC1(CN)CCOCC1.
What is the InChIKey of N-[[4-(aminomethyl)oxan-4-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine?
The InChIKey is CKWWPMSALBWPTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21F3N2O/c1-2-16(9-11(12,13)14)8-10(7-15)3-5-17-6-4-10/h2-9,15H2,1H3.
What are the key properties of N-[[4-(aminomethyl)oxan-4-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine?
N-[[4-(aminomethyl)oxan-4-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine has a molecular weight of 254.30 g/mol, XLogP of 1.63, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[4-(aminomethyl)oxan-4-yl]methyl]-N-ethyl-2,2,2-trifluoroethanamine is sourced from PubChem (CID 55066527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).