About butan-2-yl cyanate
butan-2-yl cyanate (PubChem CID 550669) has the molecular formula C5H9NO
and a molecular weight of 99.13 g/mol. Its IUPAC name is butan-2-yl cyanate.
Molecular Properties
| Compound Name | butan-2-yl cyanate |
| PubChem CID | 550669 |
| Molecular Formula | C5H9NO |
| Molecular Weight | 99.13 g/mol |
| Exact Mass | 99.07 |
| IUPAC Name | butan-2-yl cyanate |
| SMILES | CCC(C)OC#N |
| InChI | InChI=1S/C5H9NO/c1-3-5(2)7-4-6/h5H,3H2,1-2H3 |
| InChIKey | DYGSSPHDQVPDJP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.13 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze butan-2-yl cyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-yl cyanate?
The IUPAC name of butan-2-yl cyanate (CID 550669) is butan-2-yl cyanate.
What is the SMILES notation for butan-2-yl cyanate?
The canonical SMILES for butan-2-yl cyanate is CCC(C)OC#N.
What is the InChIKey of butan-2-yl cyanate?
The InChIKey is DYGSSPHDQVPDJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO/c1-3-5(2)7-4-6/h5H,3H2,1-2H3.
What are the key properties of butan-2-yl cyanate?
butan-2-yl cyanate has a molecular weight of 99.13 g/mol, XLogP of 1.28, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-yl cyanate is sourced from PubChem (CID 550669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).