About [1-[2-(2,5-dichlorophenyl)sulfanylethyl]triazol-4-yl]methanol
[1-[2-(2,5-dichlorophenyl)sulfanylethyl]triazol-4-yl]methanol (PubChem CID 55067276) has the molecular formula C11H11Cl2N3OS
and a molecular weight of 304.20 g/mol. Its IUPAC name is [1-[2-(2,5-dichlorophenyl)sulfanylethyl]triazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[2-(2,5-dichlorophenyl)sulfanylethyl]triazol-4-yl]methanol |
| PubChem CID | 55067276 |
| Molecular Formula | C11H11Cl2N3OS |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | [1-[2-(2,5-dichlorophenyl)sulfanylethyl]triazol-4-yl]methanol |
| SMILES | OCc1cn(CCSc2cc(Cl)ccc2Cl)nn1 |
| InChI | InChI=1S/C11H11Cl2N3OS/c12-8-1-2-10(13)11(5-8)18-4-3-16-6-9(7-17)14-15-16/h1-2,5-6,17H,3-4,7H2 |
| InChIKey | RYFSUCSDUHTIKN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[2-(2,5-dichlorophenyl)sulfanylethyl]triazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-(2,5-dichlorophenyl)sulfanylethyl]triazol-4-yl]methanol?
The IUPAC name of [1-[2-(2,5-dichlorophenyl)sulfanylethyl]triazol-4-yl]methanol (CID 55067276) is [1-[2-(2,5-dichlorophenyl)sulfanylethyl]triazol-4-yl]methanol.
What is the SMILES notation for [1-[2-(2,5-dichlorophenyl)sulfanylethyl]triazol-4-yl]methanol?
The canonical SMILES for [1-[2-(2,5-dichlorophenyl)sulfanylethyl]triazol-4-yl]methanol is OCc1cn(CCSc2cc(Cl)ccc2Cl)nn1.
What is the InChIKey of [1-[2-(2,5-dichlorophenyl)sulfanylethyl]triazol-4-yl]methanol?
The InChIKey is RYFSUCSDUHTIKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11Cl2N3OS/c12-8-1-2-10(13)11(5-8)18-4-3-16-6-9(7-17)14-15-16/h1-2,5-6,17H,3-4,7H2.
What are the key properties of [1-[2-(2,5-dichlorophenyl)sulfanylethyl]triazol-4-yl]methanol?
[1-[2-(2,5-dichlorophenyl)sulfanylethyl]triazol-4-yl]methanol has a molecular weight of 304.20 g/mol, XLogP of 2.87, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-(2,5-dichlorophenyl)sulfanylethyl]triazol-4-yl]methanol is sourced from PubChem (CID 55067276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).